C20H24N2O5 — CID 125132212
2-[(2S)-4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]morpholin-2-yl]acetic acid (PubChem CID 125132212) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-[(2S)-4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[(2S)-4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 125132212 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-[(2S)-4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]morpholin-2-yl]acetic acid |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)N3CCO[C@@H](CC(=O)O)C3)c2C)cc1 |
| InChI | InChI=1S/C20H24N2O5/c1-13-10-18(14(2)22(13)15-4-6-16(26-3)7-5-15)20(25)21-8-9-27-17(12-21)11-19(23)24/h4-7,10,17H,8-9,11-12H2,1-3H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | BFEHXJPAXFZCFN-KRWDZBQOSA-N |
| XLogP | 2.42 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|