C21H26N2O4 — CID 119248444
2-[4-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrole-3-carbonyl]morpholin-2-yl]acetic acid (PubChem CID 119248444) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-[4-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrole-3-carbonyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrole-3-carbonyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 119248444 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-[4-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrole-3-carbonyl]morpholin-2-yl]acetic acid |
| SMILES | Cc1cc(C)cc(-n2c(C)cc(C(=O)N3CCOC(CC(=O)O)C3)c2C)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-13-7-14(2)9-17(8-13)23-15(3)10-19(16(23)4)21(26)22-5-6-27-18(12-22)11-20(24)25/h7-10,18H,5-6,11-12H2,1-4H3,(H,24,25) |
| InChIKey | AUFRIACNBXCLCP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|