C19H22N2O5 — CID 125120584
(2S)-4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]morpholine-2-carboxylic acid (PubChem CID 125120584) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is (2S)-4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]morpholine-2-carboxylic acid.
| Compound Name | (2S)-4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 125120584 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (2S)-4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]morpholine-2-carboxylic acid |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)N3CCO[C@H](C(=O)O)C3)c2C)cc1 |
| InChI | InChI=1S/C19H22N2O5/c1-12-10-16(18(22)20-8-9-26-17(11-20)19(23)24)13(2)21(12)14-4-6-15(25-3)7-5-14/h4-7,10,17H,8-9,11H2,1-3H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | MNJLSHZBKFQXSZ-KRWDZBQOSA-N |
| XLogP | 2.03 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|