C18H24ClN3O — CID 119413143
[(3R)-3-aminopyrrolidin-1-yl]-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methanone;hydrochloride (PubChem CID 119413143) has the molecular formula C18H24ClN3O and a molecular weight of 333.86 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methanone;hydrochloride.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119413143 |
| Molecular Formula | C18H24ClN3O |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methanone;hydrochloride |
| SMILES | Cc1ccccc1-n1c(C)cc(C(=O)N2CC[C@@H](N)C2)c1C.Cl |
| InChI | InChI=1S/C18H23N3O.ClH/c1-12-6-4-5-7-17(12)21-13(2)10-16(14(21)3)18(22)20-9-8-15(19)11-20;/h4-7,10,15H,8-9,11,19H2,1-3H3;1H/t15-;/m1./s1 |
| InChIKey | KMMPBLABPWDQHF-XFULWGLBSA-N |
| XLogP | 3.00 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|