C22H26N2O3 — CID 120514633
6-[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]-6-azaspiro[2.5]octane-2-carboxylic acid (PubChem CID 120514633) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 6-[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]-6-azaspiro[2.5]octane-2-carboxylic acid.
| Compound Name | 6-[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]-6-azaspiro[2.5]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 120514633 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 6-[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]-6-azaspiro[2.5]octane-2-carboxylic acid |
| SMILES | Cc1ccccc1-n1c(C)cc(C(=O)N2CCC3(CC2)CC3C(=O)O)c1C |
| InChI | InChI=1S/C22H26N2O3/c1-14-6-4-5-7-19(14)24-15(2)12-17(16(24)3)20(25)23-10-8-22(9-11-23)13-18(22)21(26)27/h4-7,12,18H,8-11,13H2,1-3H3,(H,26,27) |
| InChIKey | CKCVAZJWUIUCGF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|