C18H20N2O3 — CID 119370736
(2R)-1-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 119370736) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is (2R)-1-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119370736 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (2R)-1-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | Cc1cc(C(=O)N2CCC[C@@H]2C(=O)O)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C18H20N2O3/c1-12-11-15(13(2)20(12)14-7-4-3-5-8-14)17(21)19-10-6-9-16(19)18(22)23/h3-5,7-8,11,16H,6,9-10H2,1-2H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | GLYKTKIKFYPYQS-MRXNPFEDSA-N |
| XLogP | 2.78 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|