C20H24N2O4 — CID 119251390
1-[2-(2,5-dimethylpyrrol-1-yl)-5-methylbenzoyl]-4-hydroxypiperidine-4-carboxylic acid (PubChem CID 119251390) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylpyrrol-1-yl)-5-methylbenzoyl]-4-hydroxypiperidine-4-carboxylic acid.
| Compound Name | 1-[2-(2,5-dimethylpyrrol-1-yl)-5-methylbenzoyl]-4-hydroxypiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119251390 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-[2-(2,5-dimethylpyrrol-1-yl)-5-methylbenzoyl]-4-hydroxypiperidine-4-carboxylic acid |
| SMILES | Cc1ccc(-n2c(C)ccc2C)c(C(=O)N2CCC(O)(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C20H24N2O4/c1-13-4-7-17(22-14(2)5-6-15(22)3)16(12-13)18(23)21-10-8-20(26,9-11-21)19(24)25/h4-7,12,26H,8-11H2,1-3H3,(H,24,25) |
| InChIKey | JJQGJBSPRGDREZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|