C16H21NO7 — CID 119251705
4-hydroxy-1-(2,4,5-trimethoxybenzoyl)piperidine-4-carboxylic acid (PubChem CID 119251705) has the molecular formula C16H21NO7 and a molecular weight of 339.34 g/mol. Its IUPAC name is 4-hydroxy-1-(2,4,5-trimethoxybenzoyl)piperidine-4-carboxylic acid.
| Compound Name | 4-hydroxy-1-(2,4,5-trimethoxybenzoyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119251705 |
| Molecular Formula | C16H21NO7 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-hydroxy-1-(2,4,5-trimethoxybenzoyl)piperidine-4-carboxylic acid |
| SMILES | COc1cc(OC)c(C(=O)N2CCC(O)(C(=O)O)CC2)cc1OC |
| InChI | InChI=1S/C16H21NO7/c1-22-11-9-13(24-3)12(23-2)8-10(11)14(18)17-6-4-16(21,5-7-17)15(19)20/h8-9,21H,4-7H2,1-3H3,(H,19,20) |
| InChIKey | QVETUZPRYUQXOC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |