C14H16N2O7 — CID 119251933
4-hydroxy-1-(4-methoxy-3-nitrobenzoyl)piperidine-4-carboxylic acid (PubChem CID 119251933) has the molecular formula C14H16N2O7 and a molecular weight of 324.29 g/mol. Its IUPAC name is 4-hydroxy-1-(4-methoxy-3-nitrobenzoyl)piperidine-4-carboxylic acid.
| Compound Name | 4-hydroxy-1-(4-methoxy-3-nitrobenzoyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119251933 |
| Molecular Formula | C14H16N2O7 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 4-hydroxy-1-(4-methoxy-3-nitrobenzoyl)piperidine-4-carboxylic acid |
| SMILES | COc1ccc(C(=O)N2CCC(O)(C(=O)O)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16N2O7/c1-23-11-3-2-9(8-10(11)16(21)22)12(17)15-6-4-14(20,5-7-15)13(18)19/h2-3,8,20H,4-7H2,1H3,(H,18,19) |
| InChIKey | XFMXIKUVUXINBR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|