C14H18N2O5 — CID 115874362
(3-hydroxy-3-methylpiperidin-1-yl)-(4-methoxy-3-nitrophenyl)methanone (PubChem CID 115874362) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is (3-hydroxy-3-methylpiperidin-1-yl)-(4-methoxy-3-nitrophenyl)methanone.
| Compound Name | (3-hydroxy-3-methylpiperidin-1-yl)-(4-methoxy-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 115874362 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (3-hydroxy-3-methylpiperidin-1-yl)-(4-methoxy-3-nitrophenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCCC(C)(O)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N2O5/c1-14(18)6-3-7-15(9-14)13(17)10-4-5-12(21-2)11(8-10)16(19)20/h4-5,8,18H,3,6-7,9H2,1-2H3 |
| InChIKey | CFULGFCQPVXCRG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|