C15H16F2N2O8 — CID 119251853
1-[4-(difluoromethoxy)-5-methoxy-2-nitrobenzoyl]-4-hydroxypiperidine-4-carboxylic acid (PubChem CID 119251853) has the molecular formula C15H16F2N2O8 and a molecular weight of 390.30 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)-5-methoxy-2-nitrobenzoyl]-4-hydroxypiperidine-4-carboxylic acid.
| Compound Name | 1-[4-(difluoromethoxy)-5-methoxy-2-nitrobenzoyl]-4-hydroxypiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119251853 |
| Molecular Formula | C15H16F2N2O8 |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 1-[4-(difluoromethoxy)-5-methoxy-2-nitrobenzoyl]-4-hydroxypiperidine-4-carboxylic acid |
| SMILES | COc1cc(C(=O)N2CCC(O)(C(=O)O)CC2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C15H16F2N2O8/c1-26-10-6-8(9(19(24)25)7-11(10)27-14(16)17)12(20)18-4-2-15(23,3-5-18)13(21)22/h6-7,14,23H,2-5H2,1H3,(H,21,22) |
| InChIKey | MTQIIPNZRFKPFJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|