C19H24F2N4O7 — CID 24671530
1-[4-[4-(difluoromethoxy)-5-methoxy-2-nitrobenzoyl]piperazin-1-yl]-2-morpholin-4-ylethanone (PubChem CID 24671530) has the molecular formula C19H24F2N4O7 and a molecular weight of 458.42 g/mol. Its IUPAC name is 1-[4-[4-(difluoromethoxy)-5-methoxy-2-nitrobenzoyl]piperazin-1-yl]-2-morpholin-4-ylethanone.
| Compound Name | 1-[4-[4-(difluoromethoxy)-5-methoxy-2-nitrobenzoyl]piperazin-1-yl]-2-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 24671530 |
| Molecular Formula | C19H24F2N4O7 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 1-[4-[4-(difluoromethoxy)-5-methoxy-2-nitrobenzoyl]piperazin-1-yl]-2-morpholin-4-ylethanone |
| SMILES | COc1cc(C(=O)N2CCN(C(=O)CN3CCOCC3)CC2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C19H24F2N4O7/c1-30-15-10-13(14(25(28)29)11-16(15)32-19(20)21)18(27)24-4-2-23(3-5-24)17(26)12-22-6-8-31-9-7-22/h10-11,19H,2-9,12H2,1H3 |
| InChIKey | LQLMYLKBKOJTSN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 114.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|