C24H28F2N2O6 — CID 24575303
[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-[4-[2-(4-ethoxyphenyl)ethyl]piperidin-1-yl]methanone (PubChem CID 24575303) has the molecular formula C24H28F2N2O6 and a molecular weight of 478.49 g/mol. Its IUPAC name is [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-[4-[2-(4-ethoxyphenyl)ethyl]piperidin-1-yl]methanone.
| Compound Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-[4-[2-(4-ethoxyphenyl)ethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 24575303 |
| Molecular Formula | C24H28F2N2O6 |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-[4-[2-(4-ethoxyphenyl)ethyl]piperidin-1-yl]methanone |
| SMILES | CCOc1ccc(CCC2CCN(C(=O)c3cc(OC)c(OC(F)F)cc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C24H28F2N2O6/c1-3-33-18-8-6-16(7-9-18)4-5-17-10-12-27(13-11-17)23(29)19-14-21(32-2)22(34-24(25)26)15-20(19)28(30)31/h6-9,14-15,17,24H,3-5,10-13H2,1-2H3 |
| InChIKey | ASYSACMWSPHZTC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|