C21H23F2N3O7S — CID 38124245
[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 38124245) has the molecular formula C21H23F2N3O7S and a molecular weight of 499.49 g/mol. Its IUPAC name is [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 38124245 |
| Molecular Formula | C21H23F2N3O7S |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | COc1cc(C(=O)N2CCN(S(=O)(=O)c3ccc(C)c(C)c3)CC2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C21H23F2N3O7S/c1-13-4-5-15(10-14(13)2)34(30,31)25-8-6-24(7-9-25)20(27)16-11-18(32-3)19(33-21(22)23)12-17(16)26(28)29/h4-5,10-12,21H,6-9H2,1-3H3 |
| InChIKey | JDLMLJBEJVFYFN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|