C18H17Cl2N3O6S — CID 27785808
(3,5-dichlorophenyl)-[4-(4-methoxy-3-nitrophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 27785808) has the molecular formula C18H17Cl2N3O6S and a molecular weight of 474.32 g/mol. Its IUPAC name is (3,5-dichlorophenyl)-[4-(4-methoxy-3-nitrophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (3,5-dichlorophenyl)-[4-(4-methoxy-3-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 27785808 |
| Molecular Formula | C18H17Cl2N3O6S |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | (3,5-dichlorophenyl)-[4-(4-methoxy-3-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)c3cc(Cl)cc(Cl)c3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17Cl2N3O6S/c1-29-17-3-2-15(11-16(17)23(25)26)30(27,28)22-6-4-21(5-7-22)18(24)12-8-13(19)10-14(20)9-12/h2-3,8-11H,4-7H2,1H3 |
| InChIKey | ICEBKXZLXLBBKF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|