C24H27ClN4O7S — CID 4852873
[1-(4-chlorobenzoyl)piperidin-3-yl]-[4-(4-methoxy-3-nitrophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 4852873) has the molecular formula C24H27ClN4O7S and a molecular weight of 551.02 g/mol. Its IUPAC name is [1-(4-chlorobenzoyl)piperidin-3-yl]-[4-(4-methoxy-3-nitrophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | [1-(4-chlorobenzoyl)piperidin-3-yl]-[4-(4-methoxy-3-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 4852873 |
| Molecular Formula | C24H27ClN4O7S |
| Molecular Weight | 551.02 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | [1-(4-chlorobenzoyl)piperidin-3-yl]-[4-(4-methoxy-3-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)C3CCCN(C(=O)c4ccc(Cl)cc4)C3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H27ClN4O7S/c1-36-22-9-8-20(15-21(22)29(32)33)37(34,35)28-13-11-26(12-14-28)24(31)18-3-2-10-27(16-18)23(30)17-4-6-19(25)7-5-17/h4-9,15,18H,2-3,10-14,16H2,1H3 |
| InChIKey | OVNVXIXYMBUZMM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 130.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.02 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|