C15H20ClF2N3O5 — CID 120809292
[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methanone;hydrochloride (PubChem CID 120809292) has the molecular formula C15H20ClF2N3O5 and a molecular weight of 395.79 g/mol. Its IUPAC name is [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methanone;hydrochloride.
| Compound Name | [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120809292 |
| Molecular Formula | C15H20ClF2N3O5 |
| Molecular Weight | 395.79 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methanone;hydrochloride |
| SMILES | COc1cc(C(=O)N2CCC(C)(CN)C2)c([N+](=O)[O-])cc1OC(F)F.Cl |
| InChI | InChI=1S/C15H19F2N3O5.ClH/c1-15(7-18)3-4-19(8-15)13(21)9-5-11(24-2)12(25-14(16)17)6-10(9)20(22)23;/h5-6,14H,3-4,7-8,18H2,1-2H3;1H |
| InChIKey | VGUMVIDRJQAHAH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.79 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|