C16H24ClN3O5 — CID 120805838
[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(4-ethoxy-5-methoxy-2-nitrophenyl)methanone;hydrochloride (PubChem CID 120805838) has the molecular formula C16H24ClN3O5 and a molecular weight of 373.84 g/mol. Its IUPAC name is [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(4-ethoxy-5-methoxy-2-nitrophenyl)methanone;hydrochloride.
| Compound Name | [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(4-ethoxy-5-methoxy-2-nitrophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120805838 |
| Molecular Formula | C16H24ClN3O5 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(4-ethoxy-5-methoxy-2-nitrophenyl)methanone;hydrochloride |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)N2CCC(C)(CN)C2)cc1OC.Cl |
| InChI | InChI=1S/C16H23N3O5.ClH/c1-4-24-14-8-12(19(21)22)11(7-13(14)23-3)15(20)18-6-5-16(2,9-17)10-18;/h7-8H,4-6,9-10,17H2,1-3H3;1H |
| InChIKey | DFLQZXGKKMXBQT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|