C21H30F2N4O5 — CID 55470385
1-(azepan-1-yl)-2-[4-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl]piperazin-1-yl]ethanone (PubChem CID 55470385) has the molecular formula C21H30F2N4O5 and a molecular weight of 456.49 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[4-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[4-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55470385 |
| Molecular Formula | C21H30F2N4O5 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 1-(azepan-1-yl)-2-[4-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl]piperazin-1-yl]ethanone |
| SMILES | COc1cc(CN2CCN(CC(=O)N3CCCCCC3)CC2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C21H30F2N4O5/c1-31-18-12-16(17(27(29)30)13-19(18)32-21(22)23)14-24-8-10-25(11-9-24)15-20(28)26-6-4-2-3-5-7-26/h12-13,21H,2-11,14-15H2,1H3 |
| InChIKey | KTUAYTFHPQRFSF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 88.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|