C22H22FN3O3 — CID 33017158
[4-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperazin-1-yl]-(furan-3-yl)methanone (PubChem CID 33017158) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is [4-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperazin-1-yl]-(furan-3-yl)methanone.
| Compound Name | [4-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperazin-1-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 33017158 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | [4-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperazin-1-yl]-(furan-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCN(C(=O)c3ccoc3)CC2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H22FN3O3/c1-15-13-20(16(2)26(15)19-5-3-18(23)4-6-19)22(28)25-10-8-24(9-11-25)21(27)17-7-12-29-14-17/h3-7,12-14H,8-11H2,1-2H3 |
| InChIKey | XOJZTERFONSUCX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|