C26H29FN4O2 — CID 42791698
4-[5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]-N,N-dimethylpiperazine-1-carboxamide (PubChem CID 42791698) has the molecular formula C26H29FN4O2 and a molecular weight of 448.54 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]-N,N-dimethylpiperazine-1-carboxamide.
| Compound Name | 4-[5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]-N,N-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 42791698 |
| Molecular Formula | C26H29FN4O2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]-N,N-dimethylpiperazine-1-carboxamide |
| SMILES | Cc1ccc(-n2c(-c3ccc(F)cc3)cc(C(=O)N3CCN(C(=O)N(C)C)CC3)c2C)cc1 |
| InChI | InChI=1S/C26H29FN4O2/c1-18-5-11-22(12-6-18)31-19(2)23(17-24(31)20-7-9-21(27)10-8-20)25(32)29-13-15-30(16-14-29)26(33)28(3)4/h5-12,17H,13-16H2,1-4H3 |
| InChIKey | YODZPDCEEMMDAX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 48.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|