C32H33FN4O2 — CID 42791680
N-(4-ethylphenyl)-4-[5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]piperazine-1-carboxamide (PubChem CID 42791680) has the molecular formula C32H33FN4O2 and a molecular weight of 524.64 g/mol. Its IUPAC name is N-(4-ethylphenyl)-4-[5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]piperazine-1-carboxamide.
| Compound Name | N-(4-ethylphenyl)-4-[5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42791680 |
| Molecular Formula | C32H33FN4O2 |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | N-(4-ethylphenyl)-4-[5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]piperazine-1-carboxamide |
| SMILES | CCc1ccc(NC(=O)N2CCN(C(=O)c3cc(-c4ccc(F)cc4)n(-c4ccc(C)cc4)c3C)CC2)cc1 |
| InChI | InChI=1S/C32H33FN4O2/c1-4-24-7-13-27(14-8-24)34-32(39)36-19-17-35(18-20-36)31(38)29-21-30(25-9-11-26(33)12-10-25)37(23(29)3)28-15-5-22(2)6-16-28/h5-16,21H,4,17-20H2,1-3H3,(H,34,39) |
| InChIKey | DYGZREHNIPXTDH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|