C30H27Cl2FN4O2 — CID 3468122
N-(2,4-dichlorophenyl)-4-[5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]piperazine-1-carboxamide (PubChem CID 3468122) has the molecular formula C30H27Cl2FN4O2 and a molecular weight of 565.48 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-4-[5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]piperazine-1-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-4-[5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3468122 |
| Molecular Formula | C30H27Cl2FN4O2 |
| Molecular Weight | 565.48 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | N-(2,4-dichlorophenyl)-4-[5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(-n2c(-c3ccc(F)cc3)cc(C(=O)N3CCN(C(=O)Nc4ccc(Cl)cc4Cl)CC3)c2C)cc1 |
| InChI | InChI=1S/C30H27Cl2FN4O2/c1-19-3-10-24(11-4-19)37-20(2)25(18-28(37)21-5-8-23(33)9-6-21)29(38)35-13-15-36(16-14-35)30(39)34-27-12-7-22(31)17-26(27)32/h3-12,17-18H,13-16H2,1-2H3,(H,34,39) |
| InChIKey | SOZRCSSYWLSULM-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.48 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|