C29H25ClF2N4O2 — CID 3873522
4-[5-(4-chlorophenyl)-1-(3-fluorophenyl)-2-methylpyrrole-3-carbonyl]-N-(2-fluorophenyl)piperazine-1-carboxamide (PubChem CID 3873522) has the molecular formula C29H25ClF2N4O2 and a molecular weight of 534.99 g/mol. Its IUPAC name is 4-[5-(4-chlorophenyl)-1-(3-fluorophenyl)-2-methylpyrrole-3-carbonyl]-N-(2-fluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[5-(4-chlorophenyl)-1-(3-fluorophenyl)-2-methylpyrrole-3-carbonyl]-N-(2-fluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3873522 |
| Molecular Formula | C29H25ClF2N4O2 |
| Molecular Weight | 534.99 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 4-[5-(4-chlorophenyl)-1-(3-fluorophenyl)-2-methylpyrrole-3-carbonyl]-N-(2-fluorophenyl)piperazine-1-carboxamide |
| SMILES | Cc1c(C(=O)N2CCN(C(=O)Nc3ccccc3F)CC2)cc(-c2ccc(Cl)cc2)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C29H25ClF2N4O2/c1-19-24(18-27(20-9-11-21(30)12-10-20)36(19)23-6-4-5-22(31)17-23)28(37)34-13-15-35(16-14-34)29(38)33-26-8-3-2-7-25(26)32/h2-12,17-18H,13-16H2,1H3,(H,33,38) |
| InChIKey | ILNZRNCXBQBVPE-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.99 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|