C30H29ClN4O3 — CID 42789101
N-(4-chlorophenyl)-4-[1-(3-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperazine-1-carboxamide (PubChem CID 42789101) has the molecular formula C30H29ClN4O3 and a molecular weight of 529.04 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[1-(3-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperazine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-[1-(3-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42789101 |
| Molecular Formula | C30H29ClN4O3 |
| Molecular Weight | 529.04 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | N-(4-chlorophenyl)-4-[1-(3-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperazine-1-carboxamide |
| SMILES | COc1cccc(-n2c(-c3ccccc3)cc(C(=O)N3CCN(C(=O)Nc4ccc(Cl)cc4)CC3)c2C)c1 |
| InChI | InChI=1S/C30H29ClN4O3/c1-21-27(20-28(22-7-4-3-5-8-22)35(21)25-9-6-10-26(19-25)38-2)29(36)33-15-17-34(18-16-33)30(37)32-24-13-11-23(31)12-14-24/h3-14,19-20H,15-18H2,1-2H3,(H,32,37) |
| InChIKey | QEGVETRCPZIWFF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.04 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|