C35H34N4O4 — CID 3640517
4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]-N-naphthalen-1-ylpiperazine-1-carboxamide (PubChem CID 3640517) has the molecular formula C35H34N4O4 and a molecular weight of 574.68 g/mol. Its IUPAC name is 4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]-N-naphthalen-1-ylpiperazine-1-carboxamide.
| Compound Name | 4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]-N-naphthalen-1-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 3640517 |
| Molecular Formula | C35H34N4O4 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]-N-naphthalen-1-ylpiperazine-1-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCN(C(=O)Nc4cccc5ccccc45)CC3)c(C)n2-c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C35H34N4O4/c1-24-31(23-33(26-14-16-28(42-2)17-15-26)39(24)27-10-7-11-29(22-27)43-3)34(40)37-18-20-38(21-19-37)35(41)36-32-13-6-9-25-8-4-5-12-30(25)32/h4-17,22-23H,18-21H2,1-3H3,(H,36,41) |
| InChIKey | UGALCFYLIQKQRA-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|