C28H33ClN4O3 — CID 3638949
N-tert-butyl-4-[5-(4-chlorophenyl)-1-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazine-1-carboxamide (PubChem CID 3638949) has the molecular formula C28H33ClN4O3 and a molecular weight of 509.05 g/mol. Its IUPAC name is N-tert-butyl-4-[5-(4-chlorophenyl)-1-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazine-1-carboxamide.
| Compound Name | N-tert-butyl-4-[5-(4-chlorophenyl)-1-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3638949 |
| Molecular Formula | C28H33ClN4O3 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | N-tert-butyl-4-[5-(4-chlorophenyl)-1-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazine-1-carboxamide |
| SMILES | COc1cccc(-n2c(-c3ccc(Cl)cc3)cc(C(=O)N3CCN(C(=O)NC(C)(C)C)CC3)c2C)c1 |
| InChI | InChI=1S/C28H33ClN4O3/c1-19-24(26(34)31-13-15-32(16-14-31)27(35)30-28(2,3)4)18-25(20-9-11-21(29)12-10-20)33(19)22-7-6-8-23(17-22)36-5/h6-12,17-18H,13-16H2,1-5H3,(H,30,35) |
| InChIKey | GXTYNKHBSPMEPJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|