C26H28ClN3O3 — CID 3486624
1-[4-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]propan-1-one (PubChem CID 3486624) has the molecular formula C26H28ClN3O3 and a molecular weight of 465.98 g/mol. Its IUPAC name is 1-[4-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 3486624 |
| Molecular Formula | C26H28ClN3O3 |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 1-[4-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(C(=O)c2cc(-c3ccc(Cl)cc3)n(-c3ccc(OC)cc3)c2C)CC1 |
| InChI | InChI=1S/C26H28ClN3O3/c1-4-25(31)28-13-15-29(16-14-28)26(32)23-17-24(19-5-7-20(27)8-6-19)30(18(23)2)21-9-11-22(33-3)12-10-21/h5-12,17H,4,13-16H2,1-3H3 |
| InChIKey | HSNHCLIEYWUBJT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|