C31H32ClN3O3 — CID 42785655
[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone (PubChem CID 42785655) has the molecular formula C31H32ClN3O3 and a molecular weight of 530.07 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [5-(4-chlorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42785655 |
| Molecular Formula | C31H32ClN3O3 |
| Molecular Weight | 530.07 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | [5-(4-chlorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone |
| SMILES | CCOc1ccccc1N1CCN(C(=O)c2cc(-c3ccc(Cl)cc3)n(-c3ccc(OC)cc3)c2C)CC1 |
| InChI | InChI=1S/C31H32ClN3O3/c1-4-38-30-8-6-5-7-28(30)33-17-19-34(20-18-33)31(36)27-21-29(23-9-11-24(32)12-10-23)35(22(27)2)25-13-15-26(37-3)16-14-25/h5-16,21H,4,17-20H2,1-3H3 |
| InChIKey | VRNRRNBOVJGGPG-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.07 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|