C29H27ClFN3O2 — CID 42665937
[4-(2-chlorophenyl)piperazin-1-yl]-[1-(4-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrol-3-yl]methanone (PubChem CID 42665937) has the molecular formula C29H27ClFN3O2 and a molecular weight of 504.01 g/mol. Its IUPAC name is [4-(2-chlorophenyl)piperazin-1-yl]-[1-(4-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrol-3-yl]methanone.
| Compound Name | [4-(2-chlorophenyl)piperazin-1-yl]-[1-(4-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrol-3-yl]methanone |
|---|---|
| PubChem CID | 42665937 |
| Molecular Formula | C29H27ClFN3O2 |
| Molecular Weight | 504.01 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | [4-(2-chlorophenyl)piperazin-1-yl]-[1-(4-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrol-3-yl]methanone |
| SMILES | COc1cccc(-c2cc(C(=O)N3CCN(c4ccccc4Cl)CC3)c(C)n2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C29H27ClFN3O2/c1-20-25(29(35)33-16-14-32(15-17-33)27-9-4-3-8-26(27)30)19-28(21-6-5-7-24(18-21)36-2)34(20)23-12-10-22(31)11-13-23/h3-13,18-19H,14-17H2,1-2H3 |
| InChIKey | HTKWAUMTXHCUPC-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.01 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|