C26H27ClFN3O3 — CID 42789075
2-chloro-1-[4-[1-(2-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]propan-1-one (PubChem CID 42789075) has the molecular formula C26H27ClFN3O3 and a molecular weight of 483.97 g/mol. Its IUPAC name is 2-chloro-1-[4-[1-(2-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]propan-1-one.
| Compound Name | 2-chloro-1-[4-[1-(2-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 42789075 |
| Molecular Formula | C26H27ClFN3O3 |
| Molecular Weight | 483.97 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 2-chloro-1-[4-[1-(2-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]propan-1-one |
| SMILES | COc1cccc(-c2cc(C(=O)N3CCN(C(=O)C(C)Cl)CC3)c(C)n2-c2ccccc2F)c1 |
| InChI | InChI=1S/C26H27ClFN3O3/c1-17(27)25(32)29-11-13-30(14-12-29)26(33)21-16-24(19-7-6-8-20(15-19)34-3)31(18(21)2)23-10-5-4-9-22(23)28/h4-10,15-17H,11-14H2,1-3H3 |
| InChIKey | ALGTYHKFIBAYKQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.97 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|