C30H34FN3O3 — CID 42791959
cyclohexyl-[4-[1-(2-fluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]methanone (PubChem CID 42791959) has the molecular formula C30H34FN3O3 and a molecular weight of 503.62 g/mol. Its IUPAC name is cyclohexyl-[4-[1-(2-fluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]methanone.
| Compound Name | cyclohexyl-[4-[1-(2-fluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42791959 |
| Molecular Formula | C30H34FN3O3 |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | cyclohexyl-[4-[1-(2-fluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]methanone |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCN(C(=O)C4CCCCC4)CC3)c(C)n2-c2ccccc2F)cc1 |
| InChI | InChI=1S/C30H34FN3O3/c1-21-25(30(36)33-18-16-32(17-19-33)29(35)23-8-4-3-5-9-23)20-28(22-12-14-24(37-2)15-13-22)34(21)27-11-7-6-10-26(27)31/h6-7,10-15,20,23H,3-5,8-9,16-19H2,1-2H3 |
| InChIKey | HZPHGTGSJFUBQY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|