C30H27ClF2N4O3 — CID 3891459
4-[1-(2-chlorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]-N-(2,4-difluorophenyl)piperazine-1-carboxamide (PubChem CID 3891459) has the molecular formula C30H27ClF2N4O3 and a molecular weight of 565.02 g/mol. Its IUPAC name is 4-[1-(2-chlorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]-N-(2,4-difluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[1-(2-chlorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]-N-(2,4-difluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3891459 |
| Molecular Formula | C30H27ClF2N4O3 |
| Molecular Weight | 565.02 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 4-[1-(2-chlorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]-N-(2,4-difluorophenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCN(C(=O)Nc4ccc(F)cc4F)CC3)c(C)n2-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C30H27ClF2N4O3/c1-19-23(18-28(20-7-10-22(40-2)11-8-20)37(19)27-6-4-3-5-24(27)31)29(38)35-13-15-36(16-14-35)30(39)34-26-12-9-21(32)17-25(26)33/h3-12,17-18H,13-16H2,1-2H3,(H,34,39) |
| InChIKey | LABPEBAQNKMHST-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.02 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|