C31H31ClN4O4 — CID 3918874
4-[1-(2-chlorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]-N-(4-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 3918874) has the molecular formula C31H31ClN4O4 and a molecular weight of 559.07 g/mol. Its IUPAC name is 4-[1-(2-chlorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]-N-(4-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[1-(2-chlorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]-N-(4-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3918874 |
| Molecular Formula | C31H31ClN4O4 |
| Molecular Weight | 559.07 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 4-[1-(2-chlorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]-N-(4-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCN(C(=O)c3cc(-c4ccc(OC)cc4)n(-c4ccccc4Cl)c3C)CC2)cc1 |
| InChI | InChI=1S/C31H31ClN4O4/c1-21-26(20-29(22-8-12-24(39-2)13-9-22)36(21)28-7-5-4-6-27(28)32)30(37)34-16-18-35(19-17-34)31(38)33-23-10-14-25(40-3)15-11-23/h4-15,20H,16-19H2,1-3H3,(H,33,38) |
| InChIKey | KQUKIGUITOSPJL-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.07 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|