C23H23ClN2O2 — CID 7231060
[1-(2-chlorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 7231060) has the molecular formula C23H23ClN2O2 and a molecular weight of 394.90 g/mol. Its IUPAC name is [1-(2-chlorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [1-(2-chlorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 7231060 |
| Molecular Formula | C23H23ClN2O2 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | [1-(2-chlorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCCC3)c(C)n2-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H23ClN2O2/c1-16-19(23(27)25-13-5-6-14-25)15-22(17-9-11-18(28-2)12-10-17)26(16)21-8-4-3-7-20(21)24/h3-4,7-12,15H,5-6,13-14H2,1-2H3 |
| InChIKey | ZLQPTCVJNDFQKB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|