C24H27ClN2O2 — CID 7230230
1-(2-chlorophenyl)-5-(4-methoxyphenyl)-2-methyl-N-[(2S)-3-methylbutan-2-yl]pyrrole-3-carboxamide (PubChem CID 7230230) has the molecular formula C24H27ClN2O2 and a molecular weight of 410.95 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-5-(4-methoxyphenyl)-2-methyl-N-[(2S)-3-methylbutan-2-yl]pyrrole-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-5-(4-methoxyphenyl)-2-methyl-N-[(2S)-3-methylbutan-2-yl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 7230230 |
| Molecular Formula | C24H27ClN2O2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-(2-chlorophenyl)-5-(4-methoxyphenyl)-2-methyl-N-[(2S)-3-methylbutan-2-yl]pyrrole-3-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)N[C@@H](C)C(C)C)c(C)n2-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C24H27ClN2O2/c1-15(2)16(3)26-24(28)20-14-23(18-10-12-19(29-5)13-11-18)27(17(20)4)22-9-7-6-8-21(22)25/h6-16H,1-5H3,(H,26,28)/t16-/m0/s1 |
| InChIKey | GSPSYLKRXNZYNS-INIZCTEOSA-N |
| XLogP | 5.89 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|