C22H23ClN2O — CID 7213171
N-butyl-1-(2-chlorophenyl)-2-methyl-5-phenylpyrrole-3-carboxamide (PubChem CID 7213171) has the molecular formula C22H23ClN2O and a molecular weight of 366.89 g/mol. Its IUPAC name is N-butyl-1-(2-chlorophenyl)-2-methyl-5-phenylpyrrole-3-carboxamide.
| Compound Name | N-butyl-1-(2-chlorophenyl)-2-methyl-5-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 7213171 |
| Molecular Formula | C22H23ClN2O |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-butyl-1-(2-chlorophenyl)-2-methyl-5-phenylpyrrole-3-carboxamide |
| SMILES | CCCCNC(=O)c1cc(-c2ccccc2)n(-c2ccccc2Cl)c1C |
| InChI | InChI=1S/C22H23ClN2O/c1-3-4-14-24-22(26)18-15-21(17-10-6-5-7-11-17)25(16(18)2)20-13-9-8-12-19(20)23/h5-13,15H,3-4,14H2,1-2H3,(H,24,26) |
| InChIKey | DXGNQNMQWOXPIS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|