C25H28ClN3O2 — CID 46126596
5-(4-chlorophenyl)-1-(2-methoxyphenyl)-2-methyl-N-(2-pyrrolidin-1-ylethyl)pyrrole-3-carboxamide (PubChem CID 46126596) has the molecular formula C25H28ClN3O2 and a molecular weight of 437.97 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(2-methoxyphenyl)-2-methyl-N-(2-pyrrolidin-1-ylethyl)pyrrole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-1-(2-methoxyphenyl)-2-methyl-N-(2-pyrrolidin-1-ylethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 46126596 |
| Molecular Formula | C25H28ClN3O2 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(2-methoxyphenyl)-2-methyl-N-(2-pyrrolidin-1-ylethyl)pyrrole-3-carboxamide |
| SMILES | COc1ccccc1-n1c(-c2ccc(Cl)cc2)cc(C(=O)NCCN2CCCC2)c1C |
| InChI | InChI=1S/C25H28ClN3O2/c1-18-21(25(30)27-13-16-28-14-5-6-15-28)17-23(19-9-11-20(26)12-10-19)29(18)22-7-3-4-8-24(22)31-2/h3-4,7-12,17H,5-6,13-16H2,1-2H3,(H,27,30) |
| InChIKey | CJQHORPLPNGRTD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|