C25H28FN3O — CID 4209005
5-(4-fluorophenyl)-2-methyl-1-(3-methylphenyl)-N-(2-pyrrolidin-1-ylethyl)pyrrole-3-carboxamide (PubChem CID 4209005) has the molecular formula C25H28FN3O and a molecular weight of 405.52 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-methyl-1-(3-methylphenyl)-N-(2-pyrrolidin-1-ylethyl)pyrrole-3-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-2-methyl-1-(3-methylphenyl)-N-(2-pyrrolidin-1-ylethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 4209005 |
| Molecular Formula | C25H28FN3O |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 5-(4-fluorophenyl)-2-methyl-1-(3-methylphenyl)-N-(2-pyrrolidin-1-ylethyl)pyrrole-3-carboxamide |
| SMILES | Cc1cccc(-n2c(-c3ccc(F)cc3)cc(C(=O)NCCN3CCCC3)c2C)c1 |
| InChI | InChI=1S/C25H28FN3O/c1-18-6-5-7-22(16-18)29-19(2)23(17-24(29)20-8-10-21(26)11-9-20)25(30)27-12-15-28-13-3-4-14-28/h5-11,16-17H,3-4,12-15H2,1-2H3,(H,27,30) |
| InChIKey | STWRMAFCAQSWHG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|