C26H31FN3O+ — CID 7289303
5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)-N-(2-piperidin-1-ium-1-ylethyl)pyrrole-3-carboxamide (PubChem CID 7289303) has the molecular formula C26H31FN3O+ and a molecular weight of 420.55 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)-N-(2-piperidin-1-ium-1-ylethyl)pyrrole-3-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)-N-(2-piperidin-1-ium-1-ylethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 7289303 |
| Molecular Formula | C26H31FN3O+ |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)-N-(2-piperidin-1-ium-1-ylethyl)pyrrole-3-carboxamide |
| SMILES | Cc1ccc(-n2c(-c3ccc(F)cc3)cc(C(=O)NCC[NH+]3CCCCC3)c2C)cc1 |
| InChI | InChI=1S/C26H30FN3O/c1-19-6-12-23(13-7-19)30-20(2)24(18-25(30)21-8-10-22(27)11-9-21)26(31)28-14-17-29-15-4-3-5-16-29/h6-13,18H,3-5,14-17H2,1-2H3,(H,28,31)/p+1 |
| InChIKey | NSWFEHQEOINEBU-UHFFFAOYSA-O |
| XLogP | 3.70 |
| TPSA | 38.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|