C24H19ClFN3O — CID 42785570
5-(4-chlorophenyl)-1-(4-fluorophenyl)-2-methyl-N-(pyridin-4-ylmethyl)pyrrole-3-carboxamide (PubChem CID 42785570) has the molecular formula C24H19ClFN3O and a molecular weight of 419.89 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(4-fluorophenyl)-2-methyl-N-(pyridin-4-ylmethyl)pyrrole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-1-(4-fluorophenyl)-2-methyl-N-(pyridin-4-ylmethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 42785570 |
| Molecular Formula | C24H19ClFN3O |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(4-fluorophenyl)-2-methyl-N-(pyridin-4-ylmethyl)pyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCc2ccncc2)cc(-c2ccc(Cl)cc2)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H19ClFN3O/c1-16-22(24(30)28-15-17-10-12-27-13-11-17)14-23(18-2-4-19(25)5-3-18)29(16)21-8-6-20(26)7-9-21/h2-14H,15H2,1H3,(H,28,30) |
| InChIKey | YHXZFKYJGOJBAD-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|