C25H20F2N2O — CID 24718469
N-benzyl-1-(2,4-difluorophenyl)-2-methyl-5-phenylpyrrole-3-carboxamide (PubChem CID 24718469) has the molecular formula C25H20F2N2O and a molecular weight of 402.44 g/mol. Its IUPAC name is N-benzyl-1-(2,4-difluorophenyl)-2-methyl-5-phenylpyrrole-3-carboxamide.
| Compound Name | N-benzyl-1-(2,4-difluorophenyl)-2-methyl-5-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 24718469 |
| Molecular Formula | C25H20F2N2O |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-benzyl-1-(2,4-difluorophenyl)-2-methyl-5-phenylpyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCc2ccccc2)cc(-c2ccccc2)n1-c1ccc(F)cc1F |
| InChI | InChI=1S/C25H20F2N2O/c1-17-21(25(30)28-16-18-8-4-2-5-9-18)15-24(19-10-6-3-7-11-19)29(17)23-13-12-20(26)14-22(23)27/h2-15H,16H2,1H3,(H,28,30) |
| InChIKey | WMYDEJAHLUQZOB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|