C21H21FN2O — CID 7212800
1-(4-fluorophenyl)-2-methyl-5-phenyl-N-propylpyrrole-3-carboxamide (PubChem CID 7212800) has the molecular formula C21H21FN2O and a molecular weight of 336.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-methyl-5-phenyl-N-propylpyrrole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-2-methyl-5-phenyl-N-propylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 7212800 |
| Molecular Formula | C21H21FN2O |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 1-(4-fluorophenyl)-2-methyl-5-phenyl-N-propylpyrrole-3-carboxamide |
| SMILES | CCCNC(=O)c1cc(-c2ccccc2)n(-c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C21H21FN2O/c1-3-13-23-21(25)19-14-20(16-7-5-4-6-8-16)24(15(19)2)18-11-9-17(22)10-12-18/h4-12,14H,3,13H2,1-2H3,(H,23,25) |
| InChIKey | SEEKHCCJSNJZGM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|