C18H14FNO2 — CID 58358774
1-(4-fluorophenyl)-2-methyl-5-phenylpyrrole-3-carboxylic acid (PubChem CID 58358774) has the molecular formula C18H14FNO2 and a molecular weight of 295.31 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-methyl-5-phenylpyrrole-3-carboxylic acid.
| Compound Name | 1-(4-fluorophenyl)-2-methyl-5-phenylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 58358774 |
| Molecular Formula | C18H14FNO2 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-(4-fluorophenyl)-2-methyl-5-phenylpyrrole-3-carboxylic acid |
| SMILES | Cc1c(C(=O)O)cc(-c2ccccc2)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H14FNO2/c1-12-16(18(21)22)11-17(13-5-3-2-4-6-13)20(12)15-9-7-14(19)8-10-15/h2-11H,1H3,(H,21,22) |
| InChIKey | BLCRFNFRXUEMKP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|