C36H32FN3O2 — CID 46127625
1-[4-[5-(4-fluorophenyl)-2-methyl-1-phenylpyrrole-3-carbonyl]piperazin-1-yl]-2,2-diphenylethanone (PubChem CID 46127625) has the molecular formula C36H32FN3O2 and a molecular weight of 557.67 g/mol. Its IUPAC name is 1-[4-[5-(4-fluorophenyl)-2-methyl-1-phenylpyrrole-3-carbonyl]piperazin-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[4-[5-(4-fluorophenyl)-2-methyl-1-phenylpyrrole-3-carbonyl]piperazin-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 46127625 |
| Molecular Formula | C36H32FN3O2 |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 1-[4-[5-(4-fluorophenyl)-2-methyl-1-phenylpyrrole-3-carbonyl]piperazin-1-yl]-2,2-diphenylethanone |
| SMILES | Cc1c(C(=O)N2CCN(C(=O)C(c3ccccc3)c3ccccc3)CC2)cc(-c2ccc(F)cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C36H32FN3O2/c1-26-32(25-33(27-17-19-30(37)20-18-27)40(26)31-15-9-4-10-16-31)35(41)38-21-23-39(24-22-38)36(42)34(28-11-5-2-6-12-28)29-13-7-3-8-14-29/h2-20,25,34H,21-24H2,1H3 |
| InChIKey | XSMLCNGUXCDQAT-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|