C25H27N3O3 — CID 7231152
1-[4-[5-(4-methoxyphenyl)-2-methyl-1-phenylpyrrole-3-carbonyl]piperazin-1-yl]ethanone (PubChem CID 7231152) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 1-[4-[5-(4-methoxyphenyl)-2-methyl-1-phenylpyrrole-3-carbonyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[5-(4-methoxyphenyl)-2-methyl-1-phenylpyrrole-3-carbonyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 7231152 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 1-[4-[5-(4-methoxyphenyl)-2-methyl-1-phenylpyrrole-3-carbonyl]piperazin-1-yl]ethanone |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCN(C(C)=O)CC3)c(C)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H27N3O3/c1-18-23(25(30)27-15-13-26(14-16-27)19(2)29)17-24(20-9-11-22(31-3)12-10-20)28(18)21-7-5-4-6-8-21/h4-12,17H,13-16H2,1-3H3 |
| InChIKey | UVEIEYSXBWACNQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|