C31H30ClN3O3 — CID 4273924
1-[4-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-2-phenylethanone (PubChem CID 4273924) has the molecular formula C31H30ClN3O3 and a molecular weight of 528.05 g/mol. Its IUPAC name is 1-[4-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-2-phenylethanone.
| Compound Name | 1-[4-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 4273924 |
| Molecular Formula | C31H30ClN3O3 |
| Molecular Weight | 528.05 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 1-[4-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-2-phenylethanone |
| SMILES | COc1ccc(-n2c(-c3ccc(Cl)cc3)cc(C(=O)N3CCN(C(=O)Cc4ccccc4)CC3)c2C)cc1 |
| InChI | InChI=1S/C31H30ClN3O3/c1-22-28(31(37)34-18-16-33(17-19-34)30(36)20-23-6-4-3-5-7-23)21-29(24-8-10-25(32)11-9-24)35(22)26-12-14-27(38-2)15-13-26/h3-15,21H,16-20H2,1-2H3 |
| InChIKey | PCYXYLYERACWTG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.05 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|