C31H29ClFN3O2 — CID 3993766
1-[4-[5-(4-chlorophenyl)-1-(3-fluorophenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-3-phenylpropan-1-one (PubChem CID 3993766) has the molecular formula C31H29ClFN3O2 and a molecular weight of 530.04 g/mol. Its IUPAC name is 1-[4-[5-(4-chlorophenyl)-1-(3-fluorophenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[4-[5-(4-chlorophenyl)-1-(3-fluorophenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 3993766 |
| Molecular Formula | C31H29ClFN3O2 |
| Molecular Weight | 530.04 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 1-[4-[5-(4-chlorophenyl)-1-(3-fluorophenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-3-phenylpropan-1-one |
| SMILES | Cc1c(C(=O)N2CCN(C(=O)CCc3ccccc3)CC2)cc(-c2ccc(Cl)cc2)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C31H29ClFN3O2/c1-22-28(21-29(24-11-13-25(32)14-12-24)36(22)27-9-5-8-26(33)20-27)31(38)35-18-16-34(17-19-35)30(37)15-10-23-6-3-2-4-7-23/h2-9,11-14,20-21H,10,15-19H2,1H3 |
| InChIKey | OPMAEMQORYHZEN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.04 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|