C28H23Cl2F2N3O — CID 42785681
[5-(4-chlorophenyl)-1-(2,4-difluorophenyl)-2-methylpyrrol-3-yl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone (PubChem CID 42785681) has the molecular formula C28H23Cl2F2N3O and a molecular weight of 526.41 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1-(2,4-difluorophenyl)-2-methylpyrrol-3-yl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone.
| Compound Name | [5-(4-chlorophenyl)-1-(2,4-difluorophenyl)-2-methylpyrrol-3-yl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42785681 |
| Molecular Formula | C28H23Cl2F2N3O |
| Molecular Weight | 526.41 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | [5-(4-chlorophenyl)-1-(2,4-difluorophenyl)-2-methylpyrrol-3-yl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCN(c3cccc(Cl)c3)CC2)cc(-c2ccc(Cl)cc2)n1-c1ccc(F)cc1F |
| InChI | InChI=1S/C28H23Cl2F2N3O/c1-18-24(28(36)34-13-11-33(12-14-34)23-4-2-3-21(30)15-23)17-27(19-5-7-20(29)8-6-19)35(18)26-10-9-22(31)16-25(26)32/h2-10,15-17H,11-14H2,1H3 |
| InChIKey | MWCLREXOHUFHIZ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.41 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|