C30H30ClN3O3 — CID 42665729
[4-(3-chlorophenyl)piperazin-1-yl]-[1-(2,4-dimethoxyphenyl)-2-methyl-5-phenylpyrrol-3-yl]methanone (PubChem CID 42665729) has the molecular formula C30H30ClN3O3 and a molecular weight of 516.04 g/mol. Its IUPAC name is [4-(3-chlorophenyl)piperazin-1-yl]-[1-(2,4-dimethoxyphenyl)-2-methyl-5-phenylpyrrol-3-yl]methanone.
| Compound Name | [4-(3-chlorophenyl)piperazin-1-yl]-[1-(2,4-dimethoxyphenyl)-2-methyl-5-phenylpyrrol-3-yl]methanone |
|---|---|
| PubChem CID | 42665729 |
| Molecular Formula | C30H30ClN3O3 |
| Molecular Weight | 516.04 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | [4-(3-chlorophenyl)piperazin-1-yl]-[1-(2,4-dimethoxyphenyl)-2-methyl-5-phenylpyrrol-3-yl]methanone |
| SMILES | COc1ccc(-n2c(-c3ccccc3)cc(C(=O)N3CCN(c4cccc(Cl)c4)CC3)c2C)c(OC)c1 |
| InChI | InChI=1S/C30H30ClN3O3/c1-21-26(30(35)33-16-14-32(15-17-33)24-11-7-10-23(31)18-24)20-28(22-8-5-4-6-9-22)34(21)27-13-12-25(36-2)19-29(27)37-3/h4-13,18-20H,14-17H2,1-3H3 |
| InChIKey | RIWVSQUVFDVORC-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.04 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|